|
CAS#: 82439-15-4 Product: 4-(1-Ethyl-3-Piperidinyl)-1H-Indole (E)-2-Butenedioate (2:1) No suppilers available for the product. |
| Name | 4-(1-Ethyl-3-Piperidinyl)-1H-Indole (E)-2-Butenedioate (2:1) |
|---|---|
| Synonyms | But-2-Enedioic Acid; 4-(1-Ethyl-3-Piperidyl)-1H-Indole; But-2-Enedioic Acid; 4-(1-Ethyl-3-Piperidinyl)-1H-Indole; 4-(1-Ethyl-3-Piperidyl)-1H-Indole Fumarate (2:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C34H44N4O4 |
| Molecular Weight | 572.75 |
| CAS Registry Number | 82439-15-4 |
| SMILES | O=C(O)\C=C\C(=O)O.C1=C[NH]C2=C1C(=CC=C2)C3CN(CCC3)CC.C(N6CC(C4=CC=CC5=C4C=C[NH]5)CCC6)C |
| InChI | 1S/2C15H20N2.C4H4O4/c2*1-2-17-10-4-5-12(11-17)13-6-3-7-15-14(13)8-9-16-15;5-3(6)1-2-4(7)8/h2*3,6-9,12,16H,2,4-5,10-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | GZNWCHJQORZRFC-WXXKFALUSA-N |
| Boiling point | 388.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 188.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Ethyl-3-Piperidinyl)-1H-Indole (E)-2-Butenedioate (2:1) |