|
CAS#: 82720-46-5 Product: N-(4-Nitrophenyl)Dimethylphosphinamide No suppilers available for the product. |
| Name | N-(4-Nitrophenyl)Dimethylphosphinamide |
|---|---|
| Synonyms | N-Dimethylphosphoryl-4-Nitro-Aniline; Dimethylphosphoryl-(4-Nitrophenyl)Amine; 4-Npph |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11N2O3P |
| Molecular Weight | 214.16 |
| CAS Registry Number | 82720-46-5 |
| SMILES | C1=C(N[P](=O)(C)C)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C8H11N2O3P/c1-14(2,13)9-7-3-5-8(6-4-7)10(11)12/h3-6H,1-2H3,(H,9,13) |
| InChIKey | FICBIFYYTQXSEY-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.42°C at 760 mmHg (Cal.) |
| Flash point | 159.076°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Nitrophenyl)Dimethylphosphinamide |