|
CAS#: 82845-25-8 Product: 4'-Bromo-2,3,4,5-Tetrachloro-1,1'-Biphenyl No suppilers available for the product. |
| Name | 4'-Bromo-2,3,4,5-Tetrachloro-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-(4-Bromophenyl)-2,3,4,5-Tetrachloro-Benzene; 1,1'-Biphenyl, 4'-Bromo-2,3,4,5-Tetrachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5BrCl4 |
| Molecular Weight | 370.89 |
| CAS Registry Number | 82845-25-8 |
| SMILES | C1=C(Cl)C(=C(C(=C1C2=CC=C(Br)C=C2)Cl)Cl)Cl |
| InChI | 1S/C12H5BrCl4/c13-7-3-1-6(2-4-7)8-5-9(14)11(16)12(17)10(8)15/h1-5H |
| InChIKey | DIWVWXQAIZHGHT-UHFFFAOYSA-N |
| Density | 1.696g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.3°C at 760 mmHg (Cal.) |
| Flash point | 224.73°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Bromo-2,3,4,5-Tetrachloro-1,1'-Biphenyl |