|
CAS#: 82868-96-0 Product: 1,8-Dihydroxy-2,3,4,6-tetramethoxy-9H-xanthen-9-one No suppilers available for the product. |
| Name | 1,8-Dihydroxy-2,3,4,6-tetramethoxy-9H-xanthen-9-one |
|---|---|
| Synonyms | 1,8-Dihydroxy-2,3,4,6-Tetramethoxy-Xanthen-9-One; 1,8-Dihydroxy-2,3,4,6-Tetramethoxy-9-Xanthenone; 1,8-Dihydroxy-2,3,4,6-Tetramethoxy-Xanthone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 |
| CAS Registry Number | 82868-96-0 |
| SMILES | C1=C(C=C(C2=C1OC3=C(C2=O)C(=C(C(=C3OC)OC)OC)O)O)OC |
| InChI | 1S/C17H16O8/c1-21-7-5-8(18)10-9(6-7)25-14-11(12(10)19)13(20)15(22-2)17(24-4)16(14)23-3/h5-6,18,20H,1-4H3 |
| InChIKey | PFIUFQOJAPBLTQ-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 598.162°C at 760 mmHg (Cal.) |
| Flash point | 221.372°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dihydroxy-2,3,4,6-tetramethoxy-9H-xanthen-9-one |