|
CAS#: 82911-12-4 Product: Fluoranthene trans-2,3-Dihydrodiol No suppilers available for the product. |
| Name | Fluoranthene trans-2,3-Dihydrodiol |
|---|---|
| Synonyms | Trans-Fluoranthene-2,3-Dihydrodiol; 2,3-Fluoranthenediol, 2,3-Dihydro-, Trans-; Brn 4466383 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 82911-12-4 |
| SMILES | [C@@H]1(O)C4=C3C(=C[C@H]1O)C2=CC=CC=C2C3=CC=C4 |
| InChI | 1S/C16H12O2/c17-14-8-13-10-5-2-1-4-9(10)11-6-3-7-12(15(11)13)16(14)18/h1-8,14,16-18H/t14-,16-/m1/s1 |
| InChIKey | WZPSABMMMAFNIT-GDBMZVCRSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.976°C at 760 mmHg (Cal.) |
| Flash point | 239.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fluoranthene trans-2,3-Dihydrodiol |