|
CAS#: 831181-42-1 Product: (5Z)-3-Methyl-5-(2-oxo-2-phenylethylidene)-2-pyrrolidinone No suppilers available for the product. |
| Name | (5Z)-3-Methyl-5-(2-oxo-2-phenylethylidene)-2-pyrrolidinone |
|---|---|
| Synonyms | 2-PYRROLI |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 831181-42-1 |
| SMILES | O=C2N/C(=C\C(=O)c1ccccc1)CC2C |
| InChI | 1S/C13H13NO2/c1-9-7-11(14-13(9)16)8-12(15)10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,14,16)/b11-8- |
| InChIKey | QGZONDATFQHQMH-FLIBITNWSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.123°C at 760 mmHg (Cal.) |
| Flash point | 174.977°C (Cal.) |
| Refractive index | 1.62 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z)-3-Methyl-5-(2-oxo-2-phenylethylidene)-2-pyrrolidinone |