|
CAS#: 831218-15-6 Product: 3-Ethyl-5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-4(3H)-ol No suppilers available for the product. |
| Name | 3-Ethyl-5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-4(3H)-ol |
|---|---|
| Synonyms | 1,2,4-Tri |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.28 |
| CAS Registry Number | 831218-15-6 |
| SMILES | CCC1NN=C(C(N1O)C)c2ccccc2 |
| InChI | 1S/C12H17N3O/c1-3-11-13-14-12(9(2)15(11)16)10-7-5-4-6-8-10/h4-9,11,13,16H,3H2,1-2H3 |
| InChIKey | VBCLTDCYFUHXBG-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.6±45.0°C at 760 mmHg (Cal.) |
| Flash point | 174.3±28.7°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-5-methyl-6-phenyl-2,5-dihydro-1,2,4-triazin-4(3H)-ol |