|
CAS#: 831181-74-9 Product: (5Z)-3-Methyl-5-[2-(4-methylphenyl)-2-oxoethylidene]-1,5-dihydro-2H-pyrrol-2-one No suppilers available for the product. |
| Name | (5Z)-3-Methyl-5-[2-(4-methylphenyl)-2-oxoethylidene]-1,5-dihydro-2H-pyrrol-2-one |
|---|---|
| Synonyms | 2H-PYRROL |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 831181-74-9 |
| SMILES | O=C2/C(=C\C(=C\C(=O)c1ccc(cc1)C)N2)C |
| InChI | 1S/C14H13NO2/c1-9-3-5-11(6-4-9)13(16)8-12-7-10(2)14(17)15-12/h3-8H,1-2H3,(H,15,17)/b12-8- |
| InChIKey | VVFNHOFFCJALKB-WQLSENKSSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.157°C at 760 mmHg (Cal.) |
| Flash point | 175.863°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z)-3-Methyl-5-[2-(4-methylphenyl)-2-oxoethylidene]-1,5-dihydro-2H-pyrrol-2-one |