|
CAS#: 83510-60-5 Product: Phenylmethyl (S)-(1-(((2-Chloroethyl)Amino)Carbonyl)-3-Methylbutyl)Carbamate No suppilers available for the product. |
| Name | Phenylmethyl (S)-(1-(((2-Chloroethyl)Amino)Carbonyl)-3-Methylbutyl)Carbamate |
|---|---|
| Synonyms | Phenylmethyl N-[(1S)-1-(2-Chloroethylcarbamoyl)-3-Methyl-Butyl]Carbamate; N-[(1S)-1-[(2-Chloroethylamino)-Oxomethyl]-3-Methylbutyl]Carbamic Acid Phenylmethyl Ester; N-[(1S)-1-(2-Chloroethylcarbamoyl)-3-Methyl-Butyl]Carbamic Acid Benzyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 |
| CAS Registry Number | 83510-60-5 |
| SMILES | [C@H](NC(=O)OCC1=CC=CC=C1)(CC(C)C)C(=O)NCCCl |
| InChI | 1S/C16H23ClN2O3/c1-12(2)10-14(15(20)18-9-8-17)19-16(21)22-11-13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | QRTZGSGKEWWPRU-AWEZNQCLSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.619°C at 760 mmHg (Cal.) |
| Flash point | 269.871°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenylmethyl (S)-(1-(((2-Chloroethyl)Amino)Carbonyl)-3-Methylbutyl)Carbamate |