|
CAS#: 83732-65-4 Product: 5-Chloro-2-(4-Chlorophenoxy)-N,N-Dimethylaniline No suppilers available for the product. |
| Name | 5-Chloro-2-(4-Chlorophenoxy)-N,N-Dimethylaniline |
|---|---|
| Synonyms | 5-Chloro-2-(4-Chlorophenoxy)-N,N-Dimethyl-Aniline; [5-Chloro-2-(4-Chlorophenoxy)Phenyl]-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 |
| CAS Registry Number | 83732-65-4 |
| EINECS | 280-615-0 |
| SMILES | C1=CC(=CC(=C1OC2=CC=C(C=C2)Cl)N(C)C)Cl |
| InChI | 1S/C14H13Cl2NO/c1-17(2)13-9-11(16)5-8-14(13)18-12-6-3-10(15)4-7-12/h3-9H,1-2H3 |
| InChIKey | MKTVSZPMNSBCOA-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.998°C at 760 mmHg (Cal.) |
| Flash point | 175.15°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-(4-Chlorophenoxy)-N,N-Dimethylaniline |