|
CAS#: 83783-81-7 Product: 2-Methylpentyl 2-Methylisocrotonate No suppilers available for the product. |
| Name | 2-Methylpentyl 2-Methylisocrotonate |
|---|---|
| Synonyms | (Z)-2-Methylbut-2-Enoic Acid 2-Methylpentyl Ester; 2-Methylpentyl 2-Methylisocrotonate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 83783-81-7 |
| EINECS | 280-815-8 |
| SMILES | C(OC(=O)C(=C\C)/C)C(CCC)C |
| InChI | 1S/C11H20O2/c1-5-7-9(3)8-13-11(12)10(4)6-2/h6,9H,5,7-8H2,1-4H3/b10-6- |
| InChIKey | SXXTZKDMFMLOCG-POHAHGRESA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.509°C at 760 mmHg (Cal.) |
| Flash point | 84.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylpentyl 2-Methylisocrotonate |