|
CAS#: 83797-05-1 Product: 3-Hydroxy-17-(4-Nitrophenyldithio)-1,3,5(10)-Estratriene No suppilers available for the product. |
| Name | 3-Hydroxy-17-(4-Nitrophenyldithio)-1,3,5(10)-Estratriene |
|---|---|
| Synonyms | Ohnpdte; 3-Hydroxy-17-(4-Nitrophenyldithio)-1,3,5(10)-Estratriene; 3-Hydroxy-17Beta-(4-Nitrophenyldithio)-1,3,5(10)-Estratriene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27NO3S2 |
| Molecular Weight | 441.60 |
| CAS Registry Number | 83797-05-1 |
| SMILES | [C@@H]23CCC1=C(C=CC(=C1)O)[C@H]2CC[C@]4([C@H]3CC[C@@H]4SSC5=CC=C(C=C5)[N+](=O)[O-])C |
| InChI | 1S/C24H27NO3S2/c1-24-13-12-20-19-9-5-17(26)14-15(19)2-8-21(20)22(24)10-11-23(24)30-29-18-6-3-16(4-7-18)25(27)28/h3-7,9,14,20-23,26H,2,8,10-13H2,1H3/t20-,21-,22+,23+,24+/m1/s1 |
| InChIKey | PYCKYYGXDFDCCB-DJCPXJLLSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.169°C at 760 mmHg (Cal.) |
| Flash point | 324.028°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-17-(4-Nitrophenyldithio)-1,3,5(10)-Estratriene |