|
CAS#: 83803-81-0 Product: Ethyl 4,4-Dimethoxy-3-Methyl-2-Butenoate No suppilers available for the product. |
| Name | Ethyl 4,4-Dimethoxy-3-Methyl-2-Butenoate |
|---|---|
| Synonyms | Ethyl (E)-4,4-Dimethoxy-3-Methyl-But-2-Enoate; (E)-4,4-Dimethoxy-3-Methylbut-2-Enoic Acid Ethyl Ester; (E)-4,4-Dimethoxy-3-Methyl-But-2-Enoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 |
| CAS Registry Number | 83803-81-0 |
| EINECS | 280-901-5 |
| SMILES | C(OC(=O)\C=C(C(OC)OC)/C)C |
| InChI | 1S/C9H16O4/c1-5-13-8(10)6-7(2)9(11-3)12-4/h6,9H,5H2,1-4H3/b7-6+ |
| InChIKey | MYHCWGDFZQZTQA-VOTSOKGWSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 240.383°C at 760 mmHg (Cal.) |
| Flash point | 97.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4,4-Dimethoxy-3-Methyl-2-Butenoate |