|
CAS#: 83833-34-5 Product: 2-(3,4-Dichlorophenyl)-2-Methoxyacetyl Chloride No suppilers available for the product. |
| Name | 2-(3,4-Dichlorophenyl)-2-Methoxyacetyl Chloride |
|---|---|
| Synonyms | 2-(3,4-Dichlorophenyl)-2-Methoxy-Acetyl Chloride; 2-(3,4-Dichlorophenyl)-2-Methoxy-Ethanoyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7Cl3O2 |
| Molecular Weight | 253.51 |
| CAS Registry Number | 83833-34-5 |
| EINECS | 281-009-9 |
| SMILES | C1=C(C(OC)C(Cl)=O)C=CC(=C1Cl)Cl |
| InChI | 1S/C9H7Cl3O2/c1-14-8(9(12)13)5-2-3-6(10)7(11)4-5/h2-4,8H,1H3 |
| InChIKey | MPPQGAXHXULEHG-UHFFFAOYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.154°C at 760 mmHg (Cal.) |
| Flash point | 129.911°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dichlorophenyl)-2-Methoxyacetyl Chloride |