|
CAS#: 83846-54-2 Product: Methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate No suppilers available for the product. |
| Name | Methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.24 |
| CAS Registry Number | 83846-54-2 |
| EINECS | 281-030-3 |
| SMILES | CC2(C)C(C1C=CC2C1)C(=O)OC |
| InChI | 1S/C11H16O2/c1-11(2)8-5-4-7(6-8)9(11)10(12)13-3/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | RHEKEOGQJMGRFN-UHFFFAOYSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.637°C at 760 mmHg (Cal.) |
| Flash point | 74.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,3-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |