|
CAS#: 83860-24-6 Product: (4Z,6Z,8Z,10E)-5,6,9,12,15a-Pentamethyl-13,14,15,15a-tetrahydro-2-benzoxacyclotridecin-3(1H)-one No suppilers available for the product. |
| Name | (4Z,6Z,8Z,10E)-5,6,9,12,15a-Pentamethyl-13,14,15,15a-tetrahydro-2-benzoxacyclotridecin-3(1H)-one |
|---|---|
| Synonyms | 12-Hydroxymethylretinoic acid δ-lactone; Retinoic acid, 12-(hydroxymethyl)-, δ-lactone, 11-cis- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 |
| CAS Registry Number | 83860-24-6 |
| SMILES | O=C/1OCC2(C(\C=C\C(=C/C=C(\C(=C\1)C)C)C)=C(/CCC2)C)C |
| InChI | 1S/C21H28O2/c1-15-8-10-16(2)18(4)13-20(22)23-14-21(5)12-6-7-17(3)19(21)11-9-15/h8-11,13H,6-7,12,14H2,1-5H3/b11-9+,15-8-,16-10-,18-13- |
| InChIKey | HEMJVRDBQOCAAN-SMGFGXPBSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.152°C at 760 mmHg (Cal.) |
| Flash point | 203.306°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4Z,6Z,8Z,10E)-5,6,9,12,15a-Pentamethyl-13,14,15,15a-tetrahydro-2-benzoxacyclotridecin-3(1H)-one |