|
CAS#: 83846-90-6 Product: 2-(2-Hydroxyethoxy)ethyl D-glucopyranoside No suppilers available for the product. |
| Name | 2-(2-Hydroxyethoxy)ethyl D-glucopyranoside |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H20O8 |
| Molecular Weight | 268.26 |
| CAS Registry Number | 83846-90-6 |
| EINECS | 281-070-1 |
| SMILES | OC[C@H]1OC(OCCOCCO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | 1S/C10H20O8/c11-1-2-16-3-4-17-10-9(15)8(14)7(13)6(5-12)18-10/h6-15H,1-5H2/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | DFVFAJRQBLQACP-ZKZCYXTQSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.784°C at 760 mmHg (Cal.) |
| Flash point | 266.341°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Hydroxyethoxy)ethyl D-glucopyranoside |