|
CAS#: 83864-78-2 Product: Obovatol No suppilers available for the product. |
| Name | Obovatol |
|---|---|
| Synonyms | 5-Allyl-3-(4-Allylphenoxy)Benzene-1,2-Diol; 5-Allyl-3-(4-Allylphenoxy)Pyrocatechol; Obovatol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 |
| CAS Registry Number | 83864-78-2 |
| SMILES | C1=C(C(=C(O)C=C1CC=C)O)OC2=CC=C(CC=C)C=C2 |
| InChI | 1S/C18H18O3/c1-3-5-13-7-9-15(10-8-13)21-17-12-14(6-4-2)11-16(19)18(17)20/h3-4,7-12,19-20H,1-2,5-6H2 |
| InChIKey | OPGPFZQBCIAFLI-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.597°C at 760 mmHg (Cal.) |
| Flash point | 203.937°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Obovatol |