|
CAS#: 83898-11-7 Product: 2-[Chloro-p-Tolylmethylene]Valeraldehyde No suppilers available for the product. |
| Name | 2-[Chloro-p-Tolylmethylene]Valeraldehyde |
|---|---|
| Synonyms | (2E)-2-[Chloro-(4-Methylphenyl)Methylene]Pentanal; (E)-3-Chloro-3-(4-Methylphenyl)-2-Propyl-Acrolein; 2-(Chloro-P-Tolylmethylene)Valeraldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 |
| CAS Registry Number | 83898-11-7 |
| EINECS | 281-219-0 |
| SMILES | C1=C(/C(Cl)=C(/CCC)C=O)C=CC(=C1)C |
| InChI | 1S/C13H15ClO/c1-3-4-12(9-15)13(14)11-7-5-10(2)6-8-11/h5-9H,3-4H2,1-2H3/b13-12+ |
| InChIKey | RQGOMHKBUMWEHS-OUKQBFOZSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.734°C at 760 mmHg (Cal.) |
| Flash point | 184.471°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Chloro-p-Tolylmethylene]Valeraldehyde |