|
CAS#: 83898-17-3 Product: 3-(2-Hydroxyphenyl)-1,1-Dimethylurea No suppilers available for the product. |
| Name | 3-(2-Hydroxyphenyl)-1,1-Dimethylurea |
|---|---|
| Synonyms | 3-(2-Hydroxyphenyl)-1,1-Dimethyl-Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 |
| CAS Registry Number | 83898-17-3 |
| EINECS | 281-225-3 |
| SMILES | C1=CC=CC(=C1NC(=O)N(C)C)O |
| InChI | 1S/C9H12N2O2/c1-11(2)9(13)10-7-5-3-4-6-8(7)12/h3-6,12H,1-2H3,(H,10,13) |
| InChIKey | VYKYSTWKUAETPR-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.22°C at 760 mmHg (Cal.) |
| Flash point | 175.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Hydroxyphenyl)-1,1-Dimethylurea |