|
CAS#: 83929-31-1 Product: 1-Chloro-4-[4-Chloro-1-(4-Fluorophenyl)-1-Butenyl]Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-[4-Chloro-1-(4-Fluorophenyl)-1-Butenyl]Benzene |
|---|---|
| Synonyms | 1-Chloro-4-(4-Chloro-1-(4-Fluorophenyl)-1-Butenyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13Cl2F |
| Molecular Weight | 295.18 |
| CAS Registry Number | 83929-31-1 |
| EINECS | 281-326-2 |
| SMILES | C2=C(\C(C1=CC=C(F)C=C1)=C/CCCl)C=CC(=C2)Cl |
| InChI | 1S/C16H13Cl2F/c17-11-1-2-16(12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h2-10H,1,11H2/b16-2+ |
| InChIKey | KGGHMPJQVZWWES-APQPDGGLSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.913°C at 760 mmHg (Cal.) |
| Flash point | 231.756°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-[4-Chloro-1-(4-Fluorophenyl)-1-Butenyl]Benzene |