|
CAS#: 84145-19-7 Product: Vinyl 3-Chloro-2,2,3,3-Tetrafluoropropionate No suppilers available for the product. |
| Name | Vinyl 3-Chloro-2,2,3,3-Tetrafluoropropionate |
|---|---|
| Synonyms | Vinyl 3-Chloro-2,2,3,3-Tetrafluoro-Propanoate; 3-Chloro-2,2,3,3-Tetrafluoropropanoic Acid Vinyl Ester; 3-Chloro-2,2,3,3-Tetrafluoro-Propionic Acid Vinyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C5H3ClF4O2 |
| Molecular Weight | 206.52 |
| CAS Registry Number | 84145-19-7 |
| EINECS | 282-243-4 |
| SMILES | O=C(OC=C)C(F)(F)C(Cl)(F)F |
| InChI | 1S/C5H3ClF4O2/c1-2-12-3(11)4(7,8)5(6,9)10/h2H,1H2 |
| InChIKey | HLZZKBZAPCCVIE-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 87.785°C at 760 mmHg (Cal.) |
| Flash point | 17.414°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vinyl 3-Chloro-2,2,3,3-Tetrafluoropropionate |