|
CAS#: 84162-64-1 Product: Pentyl 2-(2,4,5-Trichlorophenoxy)Propionate No suppilers available for the product. |
| Name | Pentyl 2-(2,4,5-Trichlorophenoxy)Propionate |
|---|---|
| Synonyms | 2-(2,4,5-Trichlorophenoxy)Propanoic Acid Pentyl Ester; 2-(2,4,5-Trichlorophenoxy)Propionic Acid Amyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17Cl3O3 |
| Molecular Weight | 339.65 |
| CAS Registry Number | 84162-64-1 |
| EINECS | 282-320-2 |
| SMILES | C1=C(Cl)C(=CC(=C1Cl)OC(C(OCCCCC)=O)C)Cl |
| InChI | 1S/C14H17Cl3O3/c1-3-4-5-6-19-14(18)9(2)20-13-8-11(16)10(15)7-12(13)17/h7-9H,3-6H2,1-2H3 |
| InChIKey | SZBKTVIRGPPGAJ-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.399°C at 760 mmHg (Cal.) |
| Flash point | 142.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentyl 2-(2,4,5-Trichlorophenoxy)Propionate |