|
CAS#: 84176-76-1 Product: 1-Benzyl-4-Phenylpiperidine-4-Carboxamide No suppilers available for the product. |
| Name | 1-Benzyl-4-Phenylpiperidine-4-Carboxamide |
|---|---|
| Synonyms | 4-Phenyl-1-(Phenylmethyl)-4-Piperidinecarboxamide; 1-(Benzyl)-4-Phenyl-Isonipecotamide; Nsc73397 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 |
| CAS Registry Number | 84176-76-1 |
| EINECS | 282-343-8 |
| SMILES | C1=CC=C(C=C1)CN2CCC(CC2)(C3=CC=CC=C3)C(=O)N |
| InChI | 1S/C19H22N2O/c20-18(22)19(17-9-5-2-6-10-17)11-13-21(14-12-19)15-16-7-3-1-4-8-16/h1-10H,11-15H2,(H2,20,22) |
| InChIKey | LTUVVZKXVNALKM-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.954°C at 760 mmHg (Cal.) |
| Flash point | 245.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-4-Phenylpiperidine-4-Carboxamide |