Online Database of Chemicals from Around the World
|
CAS#: 84176-82-9 Product: N-[4-(Acetylamino)-2-Chloro-5-Methoxyphenyl]-3-Oxobutyramide No suppilers available for the product. |
| Name | N-[4-(Acetylamino)-2-Chloro-5-Methoxyphenyl]-3-Oxobutyramide |
|---|---|
| Synonyms | N-(4-Acetamido-2-Chloro-5-Methoxy-Phenyl)-3-Oxo-Butanamide; N-(4-Acetamido-2-Chloro-5-Methoxy-Phenyl)-3-Keto-Butyramide |
| Molecular Structure | ![CAS#: 84176-82-9, N-[4-(Acetylamino)-2-Chloro-5-Methoxyphenyl]-3-Oxobutyramide](/moreStructures/84176-82-9.gif) |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 |
| CAS Registry Number | 84176-82-9 |
| EINECS | 282-349-0 |
| SMILES | C1=C(OC)C(=CC(=C1NC(=O)CC(=O)C)Cl)NC(=O)C |
| InChI | 1S/C13H15ClN2O4/c1-7(17)4-13(19)16-10-6-12(20-3)11(5-9(10)14)15-8(2)18/h5-6H,4H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | AEHKSCQHBUCHTF-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.009°C at 760 mmHg (Cal.) |
| Flash point | 270.711°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(Acetylamino)-2-Chloro-5-Methoxyphenyl]-3-Oxobutyramide |