|
CAS#: 84255-06-1 Product: 1-Benzhydryl-4-[(4-Methoxy-3-Nitrophenyl)Methyl]Piperazine No suppilers available for the product. |
| Name | 1-Benzhydryl-4-[(4-Methoxy-3-Nitrophenyl)Methyl]Piperazine |
|---|---|
| Synonyms | 1-[Di(Phenyl)Methyl]-4-[(4-Methoxy-3-Nitro-Phenyl)Methyl]Piperazine; 1-[Di(Phenyl)Methyl]-4-(4-Methoxy-3-Nitro-Benzyl)Piperazine |
| Molecular Structure | ![]() |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 |
| CAS Registry Number | 84255-06-1 |
| EINECS | 282-554-5 |
| SMILES | C4=C(CN3CCN(C(C1=CC=CC=C1)C2=CC=CC=C2)CC3)C=CC(=C4[N+]([O-])=O)OC |
| InChI | 1S/C25H27N3O3/c1-31-24-13-12-20(18-23(24)28(29)30)19-26-14-16-27(17-15-26)25(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-13,18,25H,14-17,19H2,1H3 |
| InChIKey | GDMKQKMDYSNLQY-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.256°C at 760 mmHg (Cal.) |
| Flash point | 290.214°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzhydryl-4-[(4-Methoxy-3-Nitrophenyl)Methyl]Piperazine |