|
CAS#: 84255-13-0 Product: 4-[(4-Nitrophenyl)Azo]-o-Toluidine No suppilers available for the product. |
| Name | 4-[(4-Nitrophenyl)Azo]-o-Toluidine |
|---|---|
| Synonyms | 2-Methyl-4-(4-Nitrophenyl)Azo-Aniline; 2-Methyl-4-(4-Nitrophenyl)Azoaniline; [2-Methyl-4-(4-Nitrophenyl)Azo-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 |
| CAS Registry Number | 84255-13-0 |
| EINECS | 282-560-8 |
| SMILES | C2=C(N=NC1=CC=C([N+]([O-])=O)C=C1)C=CC(=C2C)N |
| InChI | 1S/C13H12N4O2/c1-9-8-11(4-7-13(9)14)16-15-10-2-5-12(6-3-10)17(18)19/h2-8H,14H2,1H3 |
| InChIKey | YIRVXTSCTZTERY-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.239°C at 760 mmHg (Cal.) |
| Flash point | 243.635°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Nitrophenyl)Azo]-o-Toluidine |