|
CAS#: 84255-20-9 Product: 5-Methyl-2-Phenyl-1H-Imidazole-4-Carbodithioic Acid No suppilers available for the product. |
| Name | 5-Methyl-2-Phenyl-1H-Imidazole-4-Carbodithioic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.33 |
| CAS Registry Number | 84255-20-9 |
| EINECS | 282-567-6 |
| SMILES | C2=C(C1=NC(=C([NH]1)C)C(=S)S)C=CC=C2 |
| InChI | 1S/C11H10N2S2/c1-7-9(11(14)15)13-10(12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChIKey | FNKXLEZIGQBFIA-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.534°C at 760 mmHg (Cal.) |
| Flash point | 228.694°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-Phenyl-1H-Imidazole-4-Carbodithioic Acid |