|
CAS#: 84255-58-3 Product: 1-Methyl-3-[(1-Phenylethyl)Phenyl]Indan No suppilers available for the product. |
| Name | 1-Methyl-3-[(1-Phenylethyl)Phenyl]Indan |
|---|---|
| Synonyms | 1-Methyl-3-[2-(1-Phenylethyl)Phenyl]Indane; 1-Methyl-3-((1-Phenylethyl)Phenyl)Indan |
| Molecular Structure | ![]() |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.45 |
| CAS Registry Number | 84255-58-3 |
| EINECS | 282-609-3 |
| SMILES | C1=CC=CC4=C1C(C3=C(C(C2=CC=CC=C2)C)C=CC=C3)CC4C |
| InChI | 1S/C24H24/c1-17-16-24(22-14-8-6-12-20(17)22)23-15-9-7-13-21(23)18(2)19-10-4-3-5-11-19/h3-15,17-18,24H,16H2,1-2H3 |
| InChIKey | AFRNTNXQRVUPKW-UHFFFAOYSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.755°C at 760 mmHg (Cal.) |
| Flash point | 212.417°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-[(1-Phenylethyl)Phenyl]Indan |