|
CAS#: 84260-25-3 Product: 2-(4-Methoxyphenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane No suppilers available for the product. |
| Name | 2-(4-Methoxyphenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane |
|---|---|
| Synonyms | 2-(P-Methoxyphenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane; Brn 5523220; 1-Thia-3-Aza-2-Silacyclopentane, 2-(P-Methoxyphenyl)-2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NOSSi |
| Molecular Weight | 225.38 |
| CAS Registry Number | 84260-25-3 |
| SMILES | C1=CC(=CC=C1[Si]2(SCCN2)C)OC |
| InChI | 1S/C10H15NOSSi/c1-12-9-3-5-10(6-4-9)14(2)11-7-8-13-14/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | QFLGKIYWAODOLP-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.952°C at 760 mmHg (Cal.) |
| Flash point | 133.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methoxyphenyl)-2-Methyl-1-Thia-3-Aza-2-Silacyclopentane |