|
CAS#: 84255-60-7 Product: 1-Methyl-3-Phenyl(1-Phenylethyl)Indan No suppilers available for the product. |
| Name | 1-Methyl-3-Phenyl(1-Phenylethyl)Indan |
|---|---|
| Synonyms | 1-Methyl-3-Phenyl-1-(1-Phenylethyl)Indane; 1-Methyl-3-Phenyl(1-Phenylethyl)Indan |
| Molecular Structure | ![]() |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.45 |
| CAS Registry Number | 84255-60-7 |
| EINECS | 282-611-4 |
| SMILES | C1=CC=CC3=C1C(C(C2=CC=CC=C2)C)(CC3C4=CC=CC=C4)C |
| InChI | 1S/C24H24/c1-18(19-11-5-3-6-12-19)24(2)17-22(20-13-7-4-8-14-20)21-15-9-10-16-23(21)24/h3-16,18,22H,17H2,1-2H3 |
| InChIKey | KWUNDYOLBBLGIZ-UHFFFAOYSA-N |
| Density | 1.053g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.888°C at 760 mmHg (Cal.) |
| Flash point | 210.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-Phenyl(1-Phenylethyl)Indan |