|
CAS#: 84300-23-2 Product: 3-Methoxy-17-Aza-Homoandrost-5-Ene-17-One No suppilers available for the product. |
| Name | 3-Methoxy-17-Aza-Homoandrost-5-Ene-17-One |
|---|---|
| Synonyms | 3-Mahaeo; 3-Methoxy-17-Aza-Homoandrost-5-Ene-17-One |
| Molecular Structure | ![]() |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 |
| CAS Registry Number | 84300-23-2 |
| SMILES | [C@@H]4(CC[C@]1(C(=CC[C@@H]2[C@@H]1CC[C@]3([C@H]2CCC(N3)=O)C)C4)C)OC |
| InChI | 1S/C20H31NO2/c1-19-10-8-14(23-3)12-13(19)4-5-15-16(19)9-11-20(2)17(15)6-7-18(22)21-20/h4,14-17H,5-12H2,1-3H3,(H,21,22)/t14-,15+,16-,17-,19-,20-/m0/s1 |
| InChIKey | JSKPSAAKLUVICH-KCMORZRYSA-N |
| Density | 1.097g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.89°C at 760 mmHg (Cal.) |
| Flash point | 238.586°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-17-Aza-Homoandrost-5-Ene-17-One |