|
CAS#: 84434-14-0 Product: 6-(Phenylthio)-o-Anisic Acid No suppilers available for the product. |
| Name | 6-(Phenylthio)-o-Anisic Acid |
|---|---|
| Synonyms | 2-Methoxy-6-Phenylsulfanyl-Benzoic Acid; 2-Methoxy-6-(Phenylthio)Benzoic Acid; 6-(Phenylthio)-O-Anisic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 |
| CAS Registry Number | 84434-14-0 |
| EINECS | 282-813-2 |
| SMILES | C1=C(C(=C(C=C1)OC)C(O)=O)SC2=CC=CC=C2 |
| InChI | 1S/C14H12O3S/c1-17-11-8-5-9-12(13(11)14(15)16)18-10-6-3-2-4-7-10/h2-9H,1H3,(H,15,16) |
| InChIKey | ARKJMTOSOBNTRN-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.621°C at 760 mmHg (Cal.) |
| Flash point | 204.555°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Phenylthio)-o-Anisic Acid |