|
CAS#: 84434-15-1 Product: 3-(2-Ammonioethyl)-7-methyl-1H-indolium oxalate No suppilers available for the product. |
| Name | 3-(2-Ammonioethyl)-7-methyl-1H-indolium oxalate |
|---|---|
| Synonyms | 3-(2-Ammonioethyl)-7-methyl-1H-indolium oxalate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 |
| CAS Registry Number | 84434-15-1 |
| EINECS | 282-814-8 |
| SMILES | [O-]C(=O)C([O-])=O.Cc2cccc1c2[nH+]cc1CC[NH3+] |
| InChI | 1S/C11H14N2.C2H2O4/c1-8-3-2-4-10-9(5-6-12)7-13-11(8)10;3-1(4)2(5)6/h2-4,7,13H,5-6,12H2,1H3;(H,3,4)(H,5,6)/q+1;/p-1 |
| InChIKey | TXLNFJIUCIXCJS-UHFFFAOYSA-M |
| Boiling point | 563°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 294.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Ammonioethyl)-7-methyl-1H-indolium oxalate |