|
CAS#: 84434-43-5 Product: 2-Methyl-4-(phenyldiazenyl)-1,3-benzenediamine acetate (1:1) No suppilers available for the product. |
| Name | 2-Methyl-4-(phenyldiazenyl)-1,3-benzenediamine acetate (1:1) |
|---|---|
| Synonyms | 3-(phenylazo)toluene-2,6-diamine monoacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 |
| CAS Registry Number | 84434-43-5 |
| EINECS | 282-842-0 |
| SMILES | CC(O)=O.Nc2ccc(N=Nc1ccccc1)c(N)c2C |
| InChI | 1S/C13H14N4.C2H4O2/c1-9-11(14)7-8-12(13(9)15)17-16-10-5-3-2-4-6-10;1-2(3)4/h2-8H,14-15H2,1H3;1H3,(H,3,4) |
| InChIKey | JBJHXYMMZWGCIT-UHFFFAOYSA-N |
| Boiling point | 555°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 289.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-(phenyldiazenyl)-1,3-benzenediamine acetate (1:1) |