|
CAS#: 84434-85-5 Product: Lithium 3-Aminobenzoate No suppilers available for the product. |
| Name | Lithium 3-Aminobenzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H6LiNO2 |
| Molecular Weight | 143.07 |
| CAS Registry Number | 84434-85-5 |
| EINECS | 282-878-7 |
| SMILES | C1=C(C(=O)[O-])C=CC=C1N.[Li+] |
| InChI | 1S/C7H7NO2.Li/c8-6-3-1-2-5(4-6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1 |
| InChIKey | HFUNGZFRJSOZIQ-UHFFFAOYSA-M |
| Boiling point | 352.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 167°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium 3-Aminobenzoate |