|
CAS#: 84484-04-8 Product: 1-[4-(1H-Benzoimidazol-2-Ylmethoxy)Phenyl]-3-(4-Methylphenyl)Thiourea No suppilers available for the product. |
| Name | 1-[4-(1H-Benzoimidazol-2-Ylmethoxy)Phenyl]-3-(4-Methylphenyl)Thiourea |
|---|---|
| Synonyms | N-(4-(1H-Benzimidazol-2-Ylmethoxy)Phenyl)-N'-(4-Methylphenyl)Thiourea; Thiourea, N-(4-(1H-Benzimidazol-2-Ylmethoxy)Phenyl)-N'-(4-Methylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.49 |
| CAS Registry Number | 84484-04-8 |
| SMILES | C2=C1N=C([NH]C1=CC=C2)COC4=CC=C(NC(=S)NC3=CC=C(C=C3)C)C=C4 |
| InChI | 1S/C22H20N4OS/c1-15-6-8-16(9-7-15)23-22(28)24-17-10-12-18(13-11-17)27-14-21-25-19-4-2-3-5-20(19)26-21/h2-13H,14H2,1H3,(H,25,26)(H2,23,24,28) |
| InChIKey | DOUVKIRRNHPEFY-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.536°C at 760 mmHg (Cal.) |
| Flash point | 335.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(1H-Benzoimidazol-2-Ylmethoxy)Phenyl]-3-(4-Methylphenyl)Thiourea |