|
CAS#: 84540-25-0 Product: 1-(2,2,6,6-Tetramethylpiperidin-4-Yl)-1H-Pyrrole-2,5-Dione No suppilers available for the product. |
| Name | 1-(2,2,6,6-Tetramethylpiperidin-4-Yl)-1H-Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 1-(2,2,6,6-Tetramethyl-4-Piperidyl)Pyrrole-2,5-Dione; 1-(2,2,6,6-Tetramethyl-4-Piperidinyl)Pyrrole-2,5-Dione; 1-(2,2,6,6-Tetramethyl-4-Piperidyl)-3-Pyrroline-2,5-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 |
| CAS Registry Number | 84540-25-0 |
| EINECS | 283-117-1 |
| SMILES | CC2(NC(CC(N1C(=O)C=CC1=O)C2)(C)C)C |
| InChI | 1S/C13H20N2O2/c1-12(2)7-9(8-13(3,4)14-12)15-10(16)5-6-11(15)17/h5-6,9,14H,7-8H2,1-4H3 |
| InChIKey | FFIJIFGRYNWQNQ-UHFFFAOYSA-N |
| Density | 1.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.448°C at 760 mmHg (Cal.) |
| Flash point | 154.86°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,2,6,6-Tetramethylpiperidin-4-Yl)-1H-Pyrrole-2,5-Dione |