|
CAS#: 84589-11-7 Product: 7,7'-Methylenebis(3,3-dimethyl-3,4-dihydro-2H-1,4-benzothiazine) No suppilers available for the product. |
| Name | 7,7'-Methylenebis(3,3-dimethyl-3,4-dihydro-2H-1,4-benzothiazine) |
|---|---|
| Synonyms | 7,7'-meth |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26N2S2 |
| Molecular Weight | 370.57 |
| CAS Registry Number | 84589-11-7 |
| EINECS | 283-248-4 |
| SMILES | CC1(C)Nc2ccc(cc2SC1)Cc3ccc4NC(C)(C)CSc4c3 |
| InChI | 1S/C21H26N2S2/c1-20(2)12-24-18-10-14(5-7-16(18)22-20)9-15-6-8-17-19(11-15)25-13-21(3,4)23-17/h5-8,10-11,22-23H,9,12-13H2,1-4H3 |
| InChIKey | RMKZWXPGSUJDMO-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.635°C at 760 mmHg (Cal.) |
| Flash point | 268.671°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,7'-Methylenebis(3,3-dimethyl-3,4-dihydro-2H-1,4-benzothiazine) |