|
CAS#: 84604-71-7 Product: 2-Hydroxy-N-(2-hydroxyethyl)ethanaminium 2,2,4-trimethylpentanoate No suppilers available for the product. |
| Name | 2-Hydroxy-N-(2-hydroxyethyl)ethanaminium 2,2,4-trimethylpentanoate |
|---|---|
| Synonyms | bis(2-hydroxyethyl)ammonium 2,2,4-trimethylvalerate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H27NO4 |
| Molecular Weight | 249.35 |
| CAS Registry Number | 84604-71-7 |
| EINECS | 283-354-0 |
| SMILES | O=C([O-])C(C)(C)CC(C)C.OCC[NH2+]CCO |
| InChI | 1S/C8H16O2.C4H11NO2/c1-6(2)5-8(3,4)7(9)10;6-3-1-5-2-4-7/h6H,5H2,1-4H3,(H,9,10);5-7H,1-4H2 |
| InChIKey | CNEPSXJECRCUSD-UHFFFAOYSA-N |
| Boiling point | 428.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-N-(2-hydroxyethyl)ethanaminium 2,2,4-trimethylpentanoate |