|
CAS#: 84604-90-0 Product: 1,1'-Methylenebis(2,6-dichlorobenzene) No suppilers available for the product. |
| Name | 1,1'-Methylenebis(2,6-dichlorobenzene) |
|---|---|
| Synonyms | 1,1'-methylenebis[2,6-dichlorobenzene] |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8Cl4 |
| Molecular Weight | 306.01 |
| CAS Registry Number | 84604-90-0 |
| EINECS | 283-375-5 |
| SMILES | Clc2cccc(Cl)c2Cc1c(Cl)cccc1Cl |
| InChI | 1S/C13H8Cl4/c14-10-3-1-4-11(15)8(10)7-9-12(16)5-2-6-13(9)17/h1-6H,7H2 |
| InChIKey | HUNVCZYKHPLUQB-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.502°C at 760 mmHg (Cal.) |
| Flash point | 179.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Methylenebis(2,6-dichlorobenzene) |