Online Database of Chemicals from Around the World
|
CAS#: 84604-51-3 Product: (E)-2-Methoxy-4-Prop-1-Enylphenyl Isobutyrate No suppilers available for the product. |
| Name | (E)-2-Methoxy-4-Prop-1-Enylphenyl Isobutyrate |
|---|---|
| Synonyms | 2-Methylpropanoic Acid [2-Methoxy-4-[(E)-Prop-1-Enyl]Phenyl] Ester; 2-Methylpropionic Acid [2-Methoxy-4-[(E)-Prop-1-Enyl]Phenyl] Ester |
| Molecular Structure |  |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| CAS Registry Number | 84604-51-3 |
| EINECS | 283-332-0 |
| SMILES | C1=C(C(=CC(=C1)\C=C\C)OC)OC(=O)C(C)C |
| InChI | 1S/C14H18O3/c1-5-6-11-7-8-12(13(9-11)16-4)17-14(15)10(2)3/h5-10H,1-4H3/b6-5+ |
| InChIKey | HEOQGBRLGAJSLZ-AATRIKPKSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.947°C at 760 mmHg (Cal.) |
| Flash point | 127.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-2-Methoxy-4-Prop-1-Enylphenyl Isobutyrate |