|
CAS#: 84604-86-4 Product: 4,5-Dibromo-2-(4-Nitrophenoxy)Anisole No suppilers available for the product. |
| Name | 4,5-Dibromo-2-(4-Nitrophenoxy)Anisole |
|---|---|
| Synonyms | 4,5-Dibromo-2-(4-Nitrophenoxy)Anisole |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9Br2NO4 |
| Molecular Weight | 403.03 |
| CAS Registry Number | 84604-86-4 |
| EINECS | 283-370-8 |
| SMILES | C1=C(Br)C(=CC(=C1OC2=CC=C([N+]([O-])=O)C=C2)OC)Br |
| InChI | 1S/C13H9Br2NO4/c1-19-12-6-10(14)11(15)7-13(12)20-9-4-2-8(3-5-9)16(17)18/h2-7H,1H3 |
| InChIKey | RJPFFSWADWMPCT-UHFFFAOYSA-N |
| Density | 1.766g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.503°C at 760 mmHg (Cal.) |
| Flash point | 215.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dibromo-2-(4-Nitrophenoxy)Anisole |