|
CAS#: 84678-40-0 Product: 4-Ethoxybenzenesulfonic Acid 2-(Dimethylamino)Ethyl Ester No suppilers available for the product. |
| Name | 4-Ethoxybenzenesulfonic Acid 2-(Dimethylamino)Ethyl Ester |
|---|---|
| Synonyms | 4-Ethoxybenzenesulfonic Acid 2-Dimethylaminoethyl Ester; 4-Ebsde; 4-Ethoxybenzenesulfonic Acid 2-(Dimethylamino)Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 |
| CAS Registry Number | 84678-40-0 |
| SMILES | C1=CC(=CC=C1[S](=O)(=O)OCCN(C)C)OCC |
| InChI | 1S/C12H19NO4S/c1-4-16-11-5-7-12(8-6-11)18(14,15)17-10-9-13(2)3/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | UHWJLLKARQXXDO-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.262°C at 760 mmHg (Cal.) |
| Flash point | 183.776°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxybenzenesulfonic Acid 2-(Dimethylamino)Ethyl Ester |