|
CAS#: 84843-36-7 Product: Sodium octyl hydrogen phosphate No suppilers available for the product. |
| Name | Sodium octyl hydrogen phosphate |
|---|---|
| Synonyms | Phosphoric acid, octyl ester, sodium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18NaO4P |
| Molecular Weight | 232.19 |
| CAS Registry Number | 84843-36-7 |
| EINECS | 284-303-5 |
| SMILES | [Na+].[O-]P(=O)(OCCCCCCCC)O |
| InChI | 1S/C8H19O4P.Na/c1-2-3-4-5-6-7-8-12-13(9,10)11;/h2-8H2,1H3,(H2,9,10,11);/q;+1/p-1 |
| InChIKey | KOJSOGZMZDBNPG-UHFFFAOYSA-M |
| Boiling point | 328.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium octyl hydrogen phosphate |