|
CAS#: 84878-56-8 Product: 4-(2,2-Dimethoxy-1-Methylethyl)Toluene No suppilers available for the product. |
| Name | 4-(2,2-Dimethoxy-1-Methylethyl)Toluene |
|---|---|
| Synonyms | 1-(2,2-Dimethoxy-1-Methyl-Ethyl)-4-Methyl-Benzene; 1-(2,2-Dimethoxy-1-Methylethyl)-4-Methylbenzene; 1-(1,1-Dimethoxypropan-2-Yl)-4-Methyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 84878-56-8 |
| EINECS | 284-450-5 |
| SMILES | C1=C(C(C(OC)OC)C)C=CC(=C1)C |
| InChI | 1S/C12H18O2/c1-9-5-7-11(8-6-9)10(2)12(13-3)14-4/h5-8,10,12H,1-4H3 |
| InChIKey | NHCQQYMXSJZMEO-UHFFFAOYSA-N |
| Density | 0.962g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.833°C at 760 mmHg (Cal.) |
| Flash point | 70.667°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,2-Dimethoxy-1-Methylethyl)Toluene |