|
CAS#: 84946-19-0 Product: 2-[[Bis(4-Fluorophenyl)Methyl]Amino]Ethanol No suppilers available for the product. |
| Name | 2-[[Bis(4-Fluorophenyl)Methyl]Amino]Ethanol |
|---|---|
| Synonyms | 2-((Bis(4-Fluorophenyl)Methyl)Amino)Ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 |
| CAS Registry Number | 84946-19-0 |
| EINECS | 284-623-5 |
| SMILES | C1=C(F)C=CC(=C1)C(NCCO)C2=CC=C(F)C=C2 |
| InChI | 1S/C15H15F2NO/c16-13-5-1-11(2-6-13)15(18-9-10-19)12-3-7-14(17)8-4-12/h1-8,15,18-19H,9-10H2 |
| InChIKey | YWZXYBOYTASOSM-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.52°C at 760 mmHg (Cal.) |
| Flash point | 185.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[[Bis(4-Fluorophenyl)Methyl]Amino]Ethanol |