|
CAS#: 84962-44-7 Product: Methyl 3-Oxo-2-Pentylidenecyclopentaneacetate No suppilers available for the product. |
| Name | Methyl 3-Oxo-2-Pentylidenecyclopentaneacetate |
|---|---|
| Synonyms | 2-[(2E)-1-Methyl-3-Oxo-2-Pentylidene-Cyclopentyl]Acetate; 2-[(2E)-3-Keto-1-Methyl-2-Pentylidene-Cyclopentyl]Acetate; 2-[(2E)-1-Methyl-3-Oxo-2-Pentylidene-Cyclopentyl]Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19O3 |
| Molecular Weight | 223.29 |
| CAS Registry Number | 84962-44-7 |
| EINECS | 284-741-7 |
| SMILES | C(C1(C(/C(=O)CC1)=C\CCCC)C)C([O-])=O |
| InChI | 1S/C13H20O3/c1-3-4-5-6-10-11(14)7-8-13(10,2)9-12(15)16/h6H,3-5,7-9H2,1-2H3,(H,15,16)/p-1/b10-6- |
| InChIKey | YTARBOSNDHVRKB-POHAHGRESA-M |
| Boiling point | 378.796°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 197.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Oxo-2-Pentylidenecyclopentaneacetate |