|
CAS#: 84958-36-1 Product: 4-Ethenylideneandrostane-3,17-Diol No suppilers available for the product. |
| Name | 4-Ethenylideneandrostane-3,17-Diol |
|---|---|
| Synonyms | (3S,5R,8R,9S,10R,13S,14S,17S)-10,13-Dimethyl-4-Vinylidene-1,2,3,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydrocyclopenta[A]Phenanthrene-3,17-Diol; 4-Edad; 4-Ethenylidene-5Alpha-Androstane-3Beta,17Beta-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 |
| CAS Registry Number | 84958-36-1 |
| SMILES | [C@@H]1(CC[C@]3([C@H]([C]1=[C]=[CH2])CC[C@H]4[C@@H]2CC[C@@H]([C@@]2(C)CC[C@H]34)O)C)O |
| InChI | 1S/C21H32O2/c1-4-13-15-6-5-14-16-7-8-19(23)21(16,3)11-9-17(14)20(15,2)12-10-18(13)22/h14-19,22-23H,1,5-12H2,2-3H3/t14-,15-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | ZUQFXGCGZLSJOJ-QKSWPAOXSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.956°C at 760 mmHg (Cal.) |
| Flash point | 202.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethenylideneandrostane-3,17-Diol |