|
CAS#: 84962-67-4 Product: 4-(3-Oxobutyl)Phenyl Isobutyrate No suppilers available for the product. |
| Name | 4-(3-Oxobutyl)Phenyl Isobutyrate |
|---|---|
| Synonyms | 2-Methylpropanoic Acid [4-(3-Oxobutyl)Phenyl] Ester; 2-Methylpropionic Acid [4-(3-Ketobutyl)Phenyl] Ester; 4-(3-Oxobutyl)Phenyl Isobutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| CAS Registry Number | 84962-67-4 |
| EINECS | 284-765-8 |
| SMILES | C1=C(OC(=O)C(C)C)C=CC(=C1)CCC(=O)C |
| InChI | 1S/C14H18O3/c1-10(2)14(16)17-13-8-6-12(7-9-13)5-4-11(3)15/h6-10H,4-5H2,1-3H3 |
| InChIKey | VEABESDNQUAXFH-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.246°C at 760 mmHg (Cal.) |
| Flash point | 144.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Oxobutyl)Phenyl Isobutyrate |